Organic acids and derivatives
Filtered Search Results
Methyl 4-chlorocinnamate, 99%
CAS: 7560-44-3 Molecular Formula: C10H9ClO2 Molecular Weight (g/mol): 196.63 MDL Number: MFCD00075790 InChI Key: IIBXQGYKZKOORG-QPJJXVBHSA-N Synonym: methyl 4-chlorocinnamate,methyl p-chlorocinnamate,methyl 3-4-chlorophenyl acrylate,4-chlorocinnamic acid methyl ester,cinnamic acid, p-chloro-, methyl ester,2-propenoic acid, 3-4-chlorophenyl-, methyl ester,methyl e-3-4-chlorophenyl prop-2-enoate,e-methyl 3-4-chlorophenyl acrylate,methyl 2e-3-4-chlorophenyl prop-2-enoate,methyl 3-4-chlorophenyl prop-2-enoate PubChem CID: 5314314 IUPAC Name: methyl (E)-3-(4-chlorophenyl)prop-2-enoate SMILES: COC(=O)C=CC1=CC=C(C=C1)Cl
| PubChem CID | 5314314 |
|---|---|
| CAS | 7560-44-3 |
| Molecular Weight (g/mol) | 196.63 |
| MDL Number | MFCD00075790 |
| SMILES | COC(=O)C=CC1=CC=C(C=C1)Cl |
| Synonym | methyl 4-chlorocinnamate,methyl p-chlorocinnamate,methyl 3-4-chlorophenyl acrylate,4-chlorocinnamic acid methyl ester,cinnamic acid, p-chloro-, methyl ester,2-propenoic acid, 3-4-chlorophenyl-, methyl ester,methyl e-3-4-chlorophenyl prop-2-enoate,e-methyl 3-4-chlorophenyl acrylate,methyl 2e-3-4-chlorophenyl prop-2-enoate,methyl 3-4-chlorophenyl prop-2-enoate |
| IUPAC Name | methyl (E)-3-(4-chlorophenyl)prop-2-enoate |
| InChI Key | IIBXQGYKZKOORG-QPJJXVBHSA-N |
| Molecular Formula | C10H9ClO2 |
2-Ethylhexyl acrylate, 99+%, stabilized
CAS: 103-11-7 Molecular Formula: C11H20O2 Molecular Weight (g/mol): 184.28 MDL Number: MFCD00009495 InChI Key: GOXQRTZXKQZDDN-UHFFFAOYSA-N Synonym: 2-ethylhexyl acrylate,2-propenoic acid, 2-ethylhexyl ester,2-ethyl-1-hexyl acrylate,2-ethylhexyl 2-propenoate,acrylic acid, 2-ethylhexyl ester,2-ethylhexylacrylate,acrylic acid 2-ethylhexyl ester,1-hexanol, 2-ethyl-, acrylate,ccris 3430,2-ethylhexylester kyseliny akrylove PubChem CID: 7636 ChEBI: CHEBI:82465 IUPAC Name: 2-ethylhexyl prop-2-enoate SMILES: CCCCC(CC)COC(=O)C=C
| PubChem CID | 7636 |
|---|---|
| CAS | 103-11-7 |
| Molecular Weight (g/mol) | 184.28 |
| ChEBI | CHEBI:82465 |
| MDL Number | MFCD00009495 |
| SMILES | CCCCC(CC)COC(=O)C=C |
| Synonym | 2-ethylhexyl acrylate,2-propenoic acid, 2-ethylhexyl ester,2-ethyl-1-hexyl acrylate,2-ethylhexyl 2-propenoate,acrylic acid, 2-ethylhexyl ester,2-ethylhexylacrylate,acrylic acid 2-ethylhexyl ester,1-hexanol, 2-ethyl-, acrylate,ccris 3430,2-ethylhexylester kyseliny akrylove |
| IUPAC Name | 2-ethylhexyl prop-2-enoate |
| InChI Key | GOXQRTZXKQZDDN-UHFFFAOYSA-N |
| Molecular Formula | C11H20O2 |
3-Acetoxy-2-butanone, 98%
CAS: 4906-24-5 Molecular Formula: C6H10O3 Molecular Weight (g/mol): 130.14 MDL Number: MFCD00051782 InChI Key: ZKPTYCJWRHHBOW-UHFFFAOYNA-N Synonym: 3-acetoxy-2-butanone,acetoin acetate,2-acetoxy-3-butanone,2-butanone, 3-acetyloxy,3-acetyloxy-2-butanone,2-butanon-3-ol, acetate,acetic acid 1-methyl-2-oxopropyl ester,2-butanon-3-yl acetate,3-hydroxy-2-butanone acetate,acetyl methyl carbinyl acetate PubChem CID: 521246 IUPAC Name: 3-oxobutan-2-yl acetate SMILES: CC(OC(C)=O)C(C)=O
| PubChem CID | 521246 |
|---|---|
| CAS | 4906-24-5 |
| Molecular Weight (g/mol) | 130.14 |
| MDL Number | MFCD00051782 |
| SMILES | CC(OC(C)=O)C(C)=O |
| Synonym | 3-acetoxy-2-butanone,acetoin acetate,2-acetoxy-3-butanone,2-butanone, 3-acetyloxy,3-acetyloxy-2-butanone,2-butanon-3-ol, acetate,acetic acid 1-methyl-2-oxopropyl ester,2-butanon-3-yl acetate,3-hydroxy-2-butanone acetate,acetyl methyl carbinyl acetate |
| IUPAC Name | 3-oxobutan-2-yl acetate |
| InChI Key | ZKPTYCJWRHHBOW-UHFFFAOYNA-N |
| Molecular Formula | C6H10O3 |
Difluoroacetic acid, 98%
CAS: 381-73-7 Molecular Formula: C2H2F2O2 Molecular Weight (g/mol): 96.03 MDL Number: MFCD00004220 InChI Key: PBWZKZYHONABLN-UHFFFAOYSA-N Synonym: difluoroacetic acid,acetic acid, difluoro,difluoressigsaeure,1,1-difluoroacetic acid,unii-zqk1c95k3n,zqk1c95k3n,acetic acid, 2,2-difluoro,difluoroaceticacid,difluoracetic acid,difluoro-acetic acid PubChem CID: 9788 ChEBI: CHEBI:23716 IUPAC Name: 2,2-difluoroacetic acid SMILES: C(C(=O)O)(F)F
| PubChem CID | 9788 |
|---|---|
| CAS | 381-73-7 |
| Molecular Weight (g/mol) | 96.03 |
| ChEBI | CHEBI:23716 |
| MDL Number | MFCD00004220 |
| SMILES | C(C(=O)O)(F)F |
| Synonym | difluoroacetic acid,acetic acid, difluoro,difluoressigsaeure,1,1-difluoroacetic acid,unii-zqk1c95k3n,zqk1c95k3n,acetic acid, 2,2-difluoro,difluoroaceticacid,difluoracetic acid,difluoro-acetic acid |
| IUPAC Name | 2,2-difluoroacetic acid |
| InChI Key | PBWZKZYHONABLN-UHFFFAOYSA-N |
| Molecular Formula | C2H2F2O2 |
Dess-Martin periodinane
CAS: 87413-09-0 Molecular Formula: C13H13IO8 Molecular Weight (g/mol): 424.14 MDL Number: MFCD00130127 InChI Key: NKLCNNUWBJBICK-UHFFFAOYSA-N PubChem CID: 159087 SMILES: CC(=O)O[I]1(OC(C)=O)(OC(C)=O)OC(=O)C2=CC=CC=C12
| PubChem CID | 159087 |
|---|---|
| CAS | 87413-09-0 |
| Molecular Weight (g/mol) | 424.14 |
| MDL Number | MFCD00130127 |
| SMILES | CC(=O)O[I]1(OC(C)=O)(OC(C)=O)OC(=O)C2=CC=CC=C12 |
| InChI Key | NKLCNNUWBJBICK-UHFFFAOYSA-N |
| Molecular Formula | C13H13IO8 |
Ethyl fluoroacetate, 97%, Thermo Scientific Chemicals
CAS: 459-72-3 Molecular Formula: C4H7FO2 Molecular Weight (g/mol): 106.1 MDL Number: MFCD00000450 InChI Key: VCYZVXRKYPKDQB-UHFFFAOYSA-N Synonym: ethyl fluoroacetate,ethyl monofluoroacetate,acetic acid, fluoro-, ethyl ester,fluoroacetic acid ethyl ester,unii-aus1l6um7b,ethylester kyseliny fluoroctove,monofluoroacetic acid ethyl ester,aus1l6um7b,ethylester kyseliny fluoroctove czech,acetic acid, 2-fluoro-, ethyl ester PubChem CID: 9988 IUPAC Name: ethyl 2-fluoroacetate SMILES: CCOC(=O)CF
| PubChem CID | 9988 |
|---|---|
| CAS | 459-72-3 |
| Molecular Weight (g/mol) | 106.1 |
| MDL Number | MFCD00000450 |
| SMILES | CCOC(=O)CF |
| Synonym | ethyl fluoroacetate,ethyl monofluoroacetate,acetic acid, fluoro-, ethyl ester,fluoroacetic acid ethyl ester,unii-aus1l6um7b,ethylester kyseliny fluoroctove,monofluoroacetic acid ethyl ester,aus1l6um7b,ethylester kyseliny fluoroctove czech,acetic acid, 2-fluoro-, ethyl ester |
| IUPAC Name | ethyl 2-fluoroacetate |
| InChI Key | VCYZVXRKYPKDQB-UHFFFAOYSA-N |
| Molecular Formula | C4H7FO2 |
Diethyl acetylenedicarboxylate, 97%
CAS: 762-21-0 Molecular Formula: C8H10O4 Molecular Weight (g/mol): 170.17 MDL Number: MFCD00009186 InChI Key: STRNXFOUBFLVIN-UHFFFAOYSA-N Synonym: diethyl acetylenedicarboxylate,2-butynedioic acid, diethyl ester,diethyl 2-butynedioate,1,4-diethyl but-2-ynedioate,acetylenedicarboxylic acid, diethyl ester,acetylenedicarboxylic acid diethyl ester,diethylacetylenedicarboxylate,bis-ethoxycarbonyl acetylene,diethyl acetylene dicarboxylate,di-ethyl acetylenedicarboxylate PubChem CID: 69803 IUPAC Name: diethyl but-2-ynedioate SMILES: CCOC(=O)C#CC(=O)OCC
| PubChem CID | 69803 |
|---|---|
| CAS | 762-21-0 |
| Molecular Weight (g/mol) | 170.17 |
| MDL Number | MFCD00009186 |
| SMILES | CCOC(=O)C#CC(=O)OCC |
| Synonym | diethyl acetylenedicarboxylate,2-butynedioic acid, diethyl ester,diethyl 2-butynedioate,1,4-diethyl but-2-ynedioate,acetylenedicarboxylic acid, diethyl ester,acetylenedicarboxylic acid diethyl ester,diethylacetylenedicarboxylate,bis-ethoxycarbonyl acetylene,diethyl acetylene dicarboxylate,di-ethyl acetylenedicarboxylate |
| IUPAC Name | diethyl but-2-ynedioate |
| InChI Key | STRNXFOUBFLVIN-UHFFFAOYSA-N |
| Molecular Formula | C8H10O4 |
Methyl Acrylate (stabilized with MEHQ) 99.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 96-33-3 Molecular Formula: C4H6O2 Molecular Weight (g/mol): 86.09 MDL Number: MFCD00008627 InChI Key: BAPJBEWLBFYGME-UHFFFAOYSA-N Synonym: methyl acrylate,methylacrylate,acrylic acid methyl ester,2-propenoic acid, methyl ester,methyl 2-propenoate,methyl propenoate,methylacrylaat,metilacrilato,methyl-acrylat,methoxycarbonylethylene PubChem CID: 7294 ChEBI: CHEBI:82482 IUPAC Name: methyl prop-2-enoate SMILES: COC(=O)C=C
| PubChem CID | 7294 |
|---|---|
| CAS | 96-33-3 |
| Molecular Weight (g/mol) | 86.09 |
| ChEBI | CHEBI:82482 |
| MDL Number | MFCD00008627 |
| SMILES | COC(=O)C=C |
| Synonym | methyl acrylate,methylacrylate,acrylic acid methyl ester,2-propenoic acid, methyl ester,methyl 2-propenoate,methyl propenoate,methylacrylaat,metilacrilato,methyl-acrylat,methoxycarbonylethylene |
| IUPAC Name | methyl prop-2-enoate |
| InChI Key | BAPJBEWLBFYGME-UHFFFAOYSA-N |
| Molecular Formula | C4H6O2 |
Silver(I) citrate hydrate
CAS: 206986-90-5 Molecular Formula: C6H5Ag3O7 Molecular Weight (g/mol): 512.70 MDL Number: MFCD00150589 InChI Key: QUTYHQJYVDNJJA-UHFFFAOYSA-K Synonym: silver i citrate hydrate,trisilver 1+ citrate hydrate PubChem CID: 16212313 IUPAC Name: 2-hydroxypropane-1,2,3-tricarboxylic acid;silver;hydrate SMILES: [Ag+].[Ag+].[Ag+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
| PubChem CID | 16212313 |
|---|---|
| CAS | 206986-90-5 |
| Molecular Weight (g/mol) | 512.70 |
| MDL Number | MFCD00150589 |
| SMILES | [Ag+].[Ag+].[Ag+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O |
| Synonym | silver i citrate hydrate,trisilver 1+ citrate hydrate |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;silver;hydrate |
| InChI Key | QUTYHQJYVDNJJA-UHFFFAOYSA-K |
| Molecular Formula | C6H5Ag3O7 |
Sodium succinate hexahydrate
CAS: 6106-21-4 Molecular Formula: C4H16Na2O10 Molecular Weight (g/mol): 270.142 MDL Number: MFCD00149117 InChI Key: ZBTUYCUNQBRXOR-UHFFFAOYSA-L Synonym: disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate PubChem CID: 3083938 ChEBI: CHEBI:63686 IUPAC Name: disodium;butanedioate;hexahydrate SMILES: C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+]
| PubChem CID | 3083938 |
|---|---|
| CAS | 6106-21-4 |
| Molecular Weight (g/mol) | 270.142 |
| ChEBI | CHEBI:63686 |
| MDL Number | MFCD00149117 |
| SMILES | C(CC(=O)[O-])C(=O)[O-].O.O.O.O.O.O.[Na+].[Na+] |
| Synonym | disodium succinate hexahydrate,sodium succinate hexahydrate,unii-u16qod6c4e,butanedioic acid, disodium salt, hexahydrate,disodium butanedioate hexahydrate,u16qod6c4e,disodium hexahydrate succinate,sodium succinate dibasic hexahydrate,butanedioic acid disodium salt,succinic acid disodium salt hexahydrate |
| IUPAC Name | disodium;butanedioate;hexahydrate |
| InChI Key | ZBTUYCUNQBRXOR-UHFFFAOYSA-L |
| Molecular Formula | C4H16Na2O10 |
Croconic acid, 98%
CAS: 488-86-8 Molecular Formula: C5H2O5 Molecular Weight (g/mol): 142.066 MDL Number: MFCD00181389 InChI Key: RBSLJAJQOVYTRQ-UHFFFAOYSA-N Synonym: croconic acid,crocic acid,4,5-dihydroxy-4-cyclopentene-1,2,3-trione,unii-6hgy35uxaa,6hgy35uxaa,4-cyclopentene-1,2,3-trione, 4,5-dihydroxy,croconicacid,4,5-dihydroxy-4-cyclopentene-1,2,3-trione # PubChem CID: 546874 IUPAC Name: 4,5-dihydroxycyclopent-4-ene-1,2,3-trione SMILES: C1(=C(C(=O)C(=O)C1=O)O)O
| PubChem CID | 546874 |
|---|---|
| CAS | 488-86-8 |
| Molecular Weight (g/mol) | 142.066 |
| MDL Number | MFCD00181389 |
| SMILES | C1(=C(C(=O)C(=O)C1=O)O)O |
| Synonym | croconic acid,crocic acid,4,5-dihydroxy-4-cyclopentene-1,2,3-trione,unii-6hgy35uxaa,6hgy35uxaa,4-cyclopentene-1,2,3-trione, 4,5-dihydroxy,croconicacid,4,5-dihydroxy-4-cyclopentene-1,2,3-trione # |
| IUPAC Name | 4,5-dihydroxycyclopent-4-ene-1,2,3-trione |
| InChI Key | RBSLJAJQOVYTRQ-UHFFFAOYSA-N |
| Molecular Formula | C5H2O5 |
N,N-Dimethylacrylamide, 99%, stabilized with 500 ppm MEHQ
CAS: 2680-03-7 Molecular Formula: C5H9NO Molecular Weight (g/mol): 99.13 InChI Key: YLGYACDQVQQZSW-UHFFFAOYSA-N Synonym: n,n-dimethylacrylamide,2-propenamide, n,n-dimethyl,acrylamide, n,n-dimethyl,acylamide, n,n-dimethyl,n,n-dimethyl-acrylamide,n,n-dimethyl-2-propenamide,dimethylamid kyseliny akrylove,nn-dimethylacrylamide,unii-as46jk7q6i,propenamide, n,n-dimethyl PubChem CID: 17587 IUPAC Name: N,N-dimethylprop-2-enamide SMILES: CN(C)C(=O)C=C
| PubChem CID | 17587 |
|---|---|
| CAS | 2680-03-7 |
| Molecular Weight (g/mol) | 99.13 |
| SMILES | CN(C)C(=O)C=C |
| Synonym | n,n-dimethylacrylamide,2-propenamide, n,n-dimethyl,acrylamide, n,n-dimethyl,acylamide, n,n-dimethyl,n,n-dimethyl-acrylamide,n,n-dimethyl-2-propenamide,dimethylamid kyseliny akrylove,nn-dimethylacrylamide,unii-as46jk7q6i,propenamide, n,n-dimethyl |
| IUPAC Name | N,N-dimethylprop-2-enamide |
| InChI Key | YLGYACDQVQQZSW-UHFFFAOYSA-N |
| Molecular Formula | C5H9NO |
Bromoacetic acid, 98+%
CAS: 79-08-3 Molecular Formula: C2H3BrO2 Molecular Weight (g/mol): 138.95 MDL Number: MFCD00002678 InChI Key: KDPAWGWELVVRCH-UHFFFAOYSA-N Synonym: bromoacetic acid,monobromoacetic acid,bromoethanoic acid,acetic acid, bromo,to ntu,bromoacetate ion,acide bromacetique,2-bromoacetyl group,2-bromoethanoic acid,acetic acid, 2-bromo PubChem CID: 6227 IUPAC Name: 2-bromoacetic acid SMILES: C(C(=O)O)Br
| PubChem CID | 6227 |
|---|---|
| CAS | 79-08-3 |
| Molecular Weight (g/mol) | 138.95 |
| MDL Number | MFCD00002678 |
| SMILES | C(C(=O)O)Br |
| Synonym | bromoacetic acid,monobromoacetic acid,bromoethanoic acid,acetic acid, bromo,to ntu,bromoacetate ion,acide bromacetique,2-bromoacetyl group,2-bromoethanoic acid,acetic acid, 2-bromo |
| IUPAC Name | 2-bromoacetic acid |
| InChI Key | KDPAWGWELVVRCH-UHFFFAOYSA-N |
| Molecular Formula | C2H3BrO2 |
Tetrasodium Ethylenediaminetetraacetate Tetrahydrate 98.0+%, TCI America™
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 13235-36-4 Molecular Formula: C10H20N2Na4O12 Molecular Weight (g/mol): 452.23 MDL Number: MFCD00150027 InChI Key: XFLNVMPCPRLYBE-UHFFFAOYSA-J Synonym: tetrasodium ethylenediaminetetraacetate tetrahydrate,edetate sodium tetrahydrate,unii-l13nhd21x6,ethylenediaminetetraacetic acid tetrasodium salt tetrahydrate,acmc-209bp2,ksc910c4l,edta, tetrasodium tetrahydrate salt,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tetrasodium salt, tetrahydrate,ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, sodium salt, hydrate 1:4:4 PubChem CID: 23287279 IUPAC Name: tetrasodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate tetrahydrate SMILES: O.O.O.O.[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 23287279 |
|---|---|
| CAS | 13235-36-4 |
| Molecular Weight (g/mol) | 452.23 |
| MDL Number | MFCD00150027 |
| SMILES | O.O.O.O.[Na+].[Na+].[Na+].[Na+].[O-]C(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | tetrasodium ethylenediaminetetraacetate tetrahydrate,edetate sodium tetrahydrate,unii-l13nhd21x6,ethylenediaminetetraacetic acid tetrasodium salt tetrahydrate,acmc-209bp2,ksc910c4l,edta, tetrasodium tetrahydrate salt,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tetrasodium salt, tetrahydrate,ethylenediaminetetraacetic acid, tetrasodium salt tetrahydrate,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, sodium salt, hydrate 1:4:4 |
| IUPAC Name | tetrasodium 2-({2-[bis(carboxylatomethyl)amino]ethyl}(carboxylatomethyl)amino)acetate tetrahydrate |
| InChI Key | XFLNVMPCPRLYBE-UHFFFAOYSA-J |
| Molecular Formula | C10H20N2Na4O12 |
Methyl bromoacetate, 99%
CAS: 96-32-2 Molecular Formula: C3H5BrO2 Molecular Weight (g/mol): 152.98 MDL Number: MFCD00000189 InChI Key: YDCHPLOFQATIDS-UHFFFAOYSA-N Synonym: methyl bromoacetate,bromoacetic acid methyl ester,methyl monobromoacetate,acetic acid, bromo-, methyl ester,methyl alpha-bromoacetate,methylbromoacetate,acetic acid, 2-bromo-, methyl ester,methylester kyseliny bromoctove,methyl .alpha.-bromoacetate,methylester kyseliny bromoctove czech PubChem CID: 60984 IUPAC Name: methyl 2-bromoacetate SMILES: COC(=O)CBr
| PubChem CID | 60984 |
|---|---|
| CAS | 96-32-2 |
| Molecular Weight (g/mol) | 152.98 |
| MDL Number | MFCD00000189 |
| SMILES | COC(=O)CBr |
| Synonym | methyl bromoacetate,bromoacetic acid methyl ester,methyl monobromoacetate,acetic acid, bromo-, methyl ester,methyl alpha-bromoacetate,methylbromoacetate,acetic acid, 2-bromo-, methyl ester,methylester kyseliny bromoctove,methyl .alpha.-bromoacetate,methylester kyseliny bromoctove czech |
| IUPAC Name | methyl 2-bromoacetate |
| InChI Key | YDCHPLOFQATIDS-UHFFFAOYSA-N |
| Molecular Formula | C3H5BrO2 |